About 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine
5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 18716605) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
Analyze 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The IUPAC name of 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (CID 18716605) is 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
What is the SMILES notation for 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The canonical SMILES for 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine is Cc1sc(C)c2c1OCCO2.
What is the InChIKey of 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
The InChIKey is WSXSIQXFVQCFLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c1-5-7-8(6(2)11-5)10-4-3-9-7/h3-4H2,1-2H3.
What are the key properties of 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine?
5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine has a molecular weight of 170.23 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine is sourced from PubChem (CID 18716605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).