C12H14F6O2S — CID 145344251
2,5-dimethyl-3,4-bis(3,3,3-trifluoropropoxy)thiophene (PubChem CID 145344251) has the molecular formula C12H14F6O2S and a molecular weight of 336.30 g/mol. Its IUPAC name is 2,5-dimethyl-3,4-bis(3,3,3-trifluoropropoxy)thiophene.
| Compound Name | 2,5-dimethyl-3,4-bis(3,3,3-trifluoropropoxy)thiophene |
|---|---|
| PubChem CID | 145344251 |
| Molecular Formula | C12H14F6O2S |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2,5-dimethyl-3,4-bis(3,3,3-trifluoropropoxy)thiophene |
| SMILES | Cc1sc(C)c(OCCC(F)(F)F)c1OCCC(F)(F)F |
| InChI | InChI=1S/C12H14F6O2S/c1-7-9(19-5-3-11(13,14)15)10(8(2)21-7)20-6-4-12(16,17)18/h3-6H2,1-2H3 |
| InChIKey | JEFKSTFJCSNIPY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |