C27H37F11O4S — CID 158794557
3-(4,4,6,6,8,8,8-heptafluorooctoxymethyl)-6,8-dimethyl-3-(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 158794557) has the molecular formula C27H37F11O4S and a molecular weight of 666.63 g/mol. Its IUPAC name is 3-(4,4,6,6,8,8,8-heptafluorooctoxymethyl)-6,8-dimethyl-3-(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 3-(4,4,6,6,8,8,8-heptafluorooctoxymethyl)-6,8-dimethyl-3-(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 158794557 |
| Molecular Formula | C27H37F11O4S |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.22 |
| IUPAC Name | 3-(4,4,6,6,8,8,8-heptafluorooctoxymethyl)-6,8-dimethyl-3-(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | CCC(F)(F)CC(F)(F)CCCOCC1(COCCCC(F)(F)CC(F)(F)CC(F)(F)F)COc2c(C)sc(C)c2OC1 |
| InChI | InChI=1S/C27H37F11O4S/c1-4-23(28,29)11-24(30,31)7-5-9-39-14-22(16-41-20-18(2)43-19(3)21(20)42-17-22)15-40-10-6-8-25(32,33)12-26(34,35)13-27(36,37)38/h4-17H2,1-3H3 |
| InChIKey | ISRYTINNZKOQDM-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|