C27H40F8O4S — CID 157274997
6,8-dimethyl-3,3-bis(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 157274997) has the molecular formula C27H40F8O4S and a molecular weight of 612.66 g/mol. Its IUPAC name is 6,8-dimethyl-3,3-bis(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 6,8-dimethyl-3,3-bis(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 157274997 |
| Molecular Formula | C27H40F8O4S |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 6,8-dimethyl-3,3-bis(4,4,6,6-tetrafluorooctoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | CCC(F)(F)CC(F)(F)CCCOCC1(COCCCC(F)(F)CC(F)(F)CC)COc2c(C)sc(C)c2OC1 |
| InChI | InChI=1S/C27H40F8O4S/c1-5-24(28,29)13-26(32,33)9-7-11-36-15-23(17-38-21-19(3)40-20(4)22(21)39-18-23)16-37-12-8-10-27(34,35)14-25(30,31)6-2/h5-18H2,1-4H3 |
| InChIKey | AYZJZYZBRINTIT-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|