C16H30O2SSi — CID 59664288
(3,4-dibutoxy-5-methylthiophen-2-yl)-trimethylsilane (PubChem CID 59664288) has the molecular formula C16H30O2SSi and a molecular weight of 314.57 g/mol. Its IUPAC name is (3,4-dibutoxy-5-methylthiophen-2-yl)-trimethylsilane.
| Compound Name | (3,4-dibutoxy-5-methylthiophen-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 59664288 |
| Molecular Formula | C16H30O2SSi |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3,4-dibutoxy-5-methylthiophen-2-yl)-trimethylsilane |
| SMILES | CCCCOc1c(C)sc([Si](C)(C)C)c1OCCCC |
| InChI | InChI=1S/C16H30O2SSi/c1-7-9-11-17-14-13(3)19-16(20(4,5)6)15(14)18-12-10-8-2/h7-12H2,1-6H3 |
| InChIKey | SCLLJAYKLAYUPQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|