C8H12O2S — CID 15640918
3,4-dimethoxy-2,5-dimethylthiophene (PubChem CID 15640918) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 3,4-dimethoxy-2,5-dimethylthiophene.
| Compound Name | 3,4-dimethoxy-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 15640918 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 3,4-dimethoxy-2,5-dimethylthiophene |
| SMILES | COc1c(C)sc(C)c1OC |
| InChI | InChI=1S/C8H12O2S/c1-5-7(9-3)8(10-4)6(2)11-5/h1-4H3 |
| InChIKey | WEOCBJMQLLMFGY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |