C10H14O2S — CID 18346348
5,7-diethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 18346348) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 5,7-diethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-diethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 18346348 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 5,7-diethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCc1sc(CC)c2c1OCCO2 |
| InChI | InChI=1S/C10H14O2S/c1-3-7-9-10(8(4-2)13-7)12-6-5-11-9/h3-6H2,1-2H3 |
| InChIKey | DSDBQQRHFNOIEL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |