C7H10O2S — CID 19760688
3,4-dimethoxy-2-methylthiophene (PubChem CID 19760688) has the molecular formula C7H10O2S and a molecular weight of 158.22 g/mol. Its IUPAC name is 3,4-dimethoxy-2-methylthiophene.
| Compound Name | 3,4-dimethoxy-2-methylthiophene |
|---|---|
| PubChem CID | 19760688 |
| Molecular Formula | C7H10O2S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 3,4-dimethoxy-2-methylthiophene |
| SMILES | COc1csc(C)c1OC |
| InChI | InChI=1S/C7H10O2S/c1-5-7(9-3)6(8-2)4-10-5/h4H,1-3H3 |
| InChIKey | YYRFGDNTJUYNHM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |