C16H26O2S — CID 20583930
3,4-dibutoxy-2-methyl-5-[(E)-prop-1-enyl]thiophene (PubChem CID 20583930) has the molecular formula C16H26O2S and a molecular weight of 282.45 g/mol. Its IUPAC name is 3,4-dibutoxy-2-methyl-5-[(E)-prop-1-enyl]thiophene.
| Compound Name | 3,4-dibutoxy-2-methyl-5-[(E)-prop-1-enyl]thiophene |
|---|---|
| PubChem CID | 20583930 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3,4-dibutoxy-2-methyl-5-[(E)-prop-1-enyl]thiophene |
| SMILES | C/C=C/c1sc(C)c(OCCCC)c1OCCCC |
| InChI | InChI=1S/C16H26O2S/c1-5-8-11-17-15-13(4)19-14(10-7-3)16(15)18-12-9-6-2/h7,10H,5-6,8-9,11-12H2,1-4H3/b10-7+ |
| InChIKey | YPLVNBYKLHLXCR-JXMROGBWSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|