C25H40O3S2 — CID 54484872
3-decoxy-2,4,5-trimethylthiophene;5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 54484872) has the molecular formula C25H40O3S2 and a molecular weight of 452.73 g/mol. Its IUPAC name is 3-decoxy-2,4,5-trimethylthiophene;5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 3-decoxy-2,4,5-trimethylthiophene;5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 54484872 |
| Molecular Formula | C25H40O3S2 |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 3-decoxy-2,4,5-trimethylthiophene;5,7-dimethyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCCCCCCCCCOc1c(C)sc(C)c1C.Cc1sc(C)c2c1OCCO2 |
| InChI | InChI=1S/C17H30OS.C8H10O2S/c1-5-6-7-8-9-10-11-12-13-18-17-14(2)15(3)19-16(17)4;1-5-7-8(6(2)11-5)10-4-3-9-7/h5-13H2,1-4H3;3-4H2,1-2H3 |
| InChIKey | XRPHWUGLGPQLRU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|