C22H38O4 — CID 154435022
3,4-diheptoxy-5,6-dimethylbenzene-1,2-diol (PubChem CID 154435022) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 3,4-diheptoxy-5,6-dimethylbenzene-1,2-diol.
| Compound Name | 3,4-diheptoxy-5,6-dimethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435022 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 3,4-diheptoxy-5,6-dimethylbenzene-1,2-diol |
| SMILES | CCCCCCCOc1c(C)c(C)c(O)c(O)c1OCCCCCCC |
| InChI | InChI=1S/C22H38O4/c1-5-7-9-11-13-15-25-21-18(4)17(3)19(23)20(24)22(21)26-16-14-12-10-8-6-2/h23-24H,5-16H2,1-4H3 |
| InChIKey | MTSJDNDSETYHSR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|