C12H16O — CID 167473800
2,5,8-trimethyl-3,4-dihydro-2H-chromene (PubChem CID 167473800) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,5,8-trimethyl-3,4-dihydro-2H-chromene.
| Compound Name | 2,5,8-trimethyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 167473800 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2,5,8-trimethyl-3,4-dihydro-2H-chromene |
| SMILES | Cc1ccc(C)c2c1CCC(C)O2 |
| InChI | InChI=1S/C12H16O/c1-8-4-5-9(2)12-11(8)7-6-10(3)13-12/h4-5,10H,6-7H2,1-3H3 |
| InChIKey | YUBNRHSHSGLNHD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |