C15H20O2 — CID 155713423
(2S)-6-ethenoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene (PubChem CID 155713423) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2S)-6-ethenoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene.
| Compound Name | (2S)-6-ethenoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 155713423 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2S)-6-ethenoxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene |
| SMILES | C=COc1c(C)c(C)c2c(c1C)CC[C@H](C)O2 |
| InChI | InChI=1S/C15H20O2/c1-6-16-14-10(3)11(4)15-13(12(14)5)8-7-9(2)17-15/h6,9H,1,7-8H2,2-5H3/t9-/m0/s1 |
| InChIKey | MCZVNAHNKZSOEN-VIFPVBQESA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|