C17H24O3 — CID 176951971
(2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-yl) 2-methylpropanoate (PubChem CID 176951971) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-yl) 2-methylpropanoate.
| Compound Name | (2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 176951971 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-yl) 2-methylpropanoate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)C(C)C)CCC(C)O2 |
| InChI | InChI=1S/C17H24O3/c1-9(2)17(18)20-15-11(4)12(5)16-14(13(15)6)8-7-10(3)19-16/h9-10H,7-8H2,1-6H3 |
| InChIKey | GZIMHVADFKNQFR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|