C11H16N2O — CID 163270079
2-methoxy-4,7-dimethyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 163270079) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-methoxy-4,7-dimethyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 2-methoxy-4,7-dimethyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 163270079 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-methoxy-4,7-dimethyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | COc1nc(C)c2c(n1)CC(C)CC2 |
| InChI | InChI=1S/C11H16N2O/c1-7-4-5-9-8(2)12-11(14-3)13-10(9)6-7/h7H,4-6H2,1-3H3 |
| InChIKey | WACMFYFJNOXJLR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |