About 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine
2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 156555750) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
Analyze 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The IUPAC name of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine (CID 156555750) is 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
What is the SMILES notation for 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The canonical SMILES for 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine is COc1nc2c(c(OC)n1)CCC2.
What is the InChIKey of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The InChIKey is MDMIHAONQWZJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-12-8-6-4-3-5-7(6)10-9(11-8)13-2/h3-5H2,1-2H3.
What are the key properties of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine has a molecular weight of 180.21 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidine is sourced from PubChem (CID 156555750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).