C11H19N3 — CID 163270671
4,7-dimethyl-5,6,7,8-tetrahydroquinazoline;methanamine (PubChem CID 163270671) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 4,7-dimethyl-5,6,7,8-tetrahydroquinazoline;methanamine.
| Compound Name | 4,7-dimethyl-5,6,7,8-tetrahydroquinazoline;methanamine |
|---|---|
| PubChem CID | 163270671 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 4,7-dimethyl-5,6,7,8-tetrahydroquinazoline;methanamine |
| SMILES | CN.Cc1ncnc2c1CCC(C)C2 |
| InChI | InChI=1S/C10H14N2.CH5N/c1-7-3-4-9-8(2)11-6-12-10(9)5-7;1-2/h6-7H,3-5H2,1-2H3;2H2,1H3 |
| InChIKey | OXBPRFLFVXYPII-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |