C10H14N4 — CID 129060155
1-(aminodiazenyl)-6-methyl-5,6,7,8-tetrahydroisoquinoline (PubChem CID 129060155) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(aminodiazenyl)-6-methyl-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 1-(aminodiazenyl)-6-methyl-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 129060155 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-(aminodiazenyl)-6-methyl-5,6,7,8-tetrahydroisoquinoline |
| SMILES | CC1CCc2c(ccnc2/N=N/N)C1 |
| InChI | InChI=1S/C10H14N4/c1-7-2-3-9-8(6-7)4-5-12-10(9)13-14-11/h4-5,7H,2-3,6H2,1H3,(H2,11,12,13) |
| InChIKey | QKVHIRSAHKBJGY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|