C10H16Si — CID 101343850
(2,3,5,6-tetramethylphenyl)silane (PubChem CID 101343850) has the molecular formula C10H16Si and a molecular weight of 164.32 g/mol. Its IUPAC name is (2,3,5,6-tetramethylphenyl)silane.
| Compound Name | (2,3,5,6-tetramethylphenyl)silane |
|---|---|
| PubChem CID | 101343850 |
| Molecular Formula | C10H16Si |
| Molecular Weight | 164.32 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (2,3,5,6-tetramethylphenyl)silane |
| SMILES | Cc1cc(C)c(C)c([SiH3])c1C |
| InChI | InChI=1S/C10H16Si/c1-6-5-7(2)9(4)10(11)8(6)3/h5H,1-4,11H3 |
| InChIKey | GQTVPULSFMWBHS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|