C9H15ClN2 — CID 172622326
4-chloro-3,6-dimethylpyridin-2-amine;ethane (PubChem CID 172622326) has the molecular formula C9H15ClN2 and a molecular weight of 186.69 g/mol. Its IUPAC name is 4-chloro-3,6-dimethylpyridin-2-amine;ethane.
| Compound Name | 4-chloro-3,6-dimethylpyridin-2-amine;ethane |
|---|---|
| PubChem CID | 172622326 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-chloro-3,6-dimethylpyridin-2-amine;ethane |
| SMILES | CC.Cc1cc(Cl)c(C)c(N)n1 |
| InChI | InChI=1S/C7H9ClN2.C2H6/c1-4-3-6(8)5(2)7(9)10-4;1-2/h3H,1-2H3,(H2,9,10);1-2H3 |
| InChIKey | NNYLUFQLFMKUNH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |