C20H18N4 — CID 132512654
6-(2,3-dimethylquinoxalin-6-yl)-2,3-dimethylquinoxaline (PubChem CID 132512654) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-(2,3-dimethylquinoxalin-6-yl)-2,3-dimethylquinoxaline.
| Compound Name | 6-(2,3-dimethylquinoxalin-6-yl)-2,3-dimethylquinoxaline |
|---|---|
| PubChem CID | 132512654 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-(2,3-dimethylquinoxalin-6-yl)-2,3-dimethylquinoxaline |
| SMILES | Cc1nc2ccc(-c3ccc4nc(C)c(C)nc4c3)cc2nc1C |
| InChI | InChI=1S/C20H18N4/c1-11-13(3)23-19-9-15(5-7-17(19)21-11)16-6-8-18-20(10-16)24-14(4)12(2)22-18/h5-10H,1-4H3 |
| InChIKey | LWDQPLNZUPIJGG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |