About 6-(2-chloroethyl)-2,3-dimethylquinoxaline
6-(2-chloroethyl)-2,3-dimethylquinoxaline (PubChem CID 18436913) has the molecular formula C12H13ClN2
and a molecular weight of 220.70 g/mol. Its IUPAC name is 6-(2-chloroethyl)-2,3-dimethylquinoxaline.
Molecular Properties
| Compound Name | 6-(2-chloroethyl)-2,3-dimethylquinoxaline |
| PubChem CID | 18436913 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 6-(2-chloroethyl)-2,3-dimethylquinoxaline |
| SMILES | Cc1nc2ccc(CCCl)cc2nc1C |
| InChI | InChI=1S/C12H13ClN2/c1-8-9(2)15-12-7-10(5-6-13)3-4-11(12)14-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | VQHMLWGYXDDTKQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-chloroethyl)-2,3-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloroethyl)-2,3-dimethylquinoxaline?
The IUPAC name of 6-(2-chloroethyl)-2,3-dimethylquinoxaline (CID 18436913) is 6-(2-chloroethyl)-2,3-dimethylquinoxaline.
What is the SMILES notation for 6-(2-chloroethyl)-2,3-dimethylquinoxaline?
The canonical SMILES for 6-(2-chloroethyl)-2,3-dimethylquinoxaline is Cc1nc2ccc(CCCl)cc2nc1C.
What is the InChIKey of 6-(2-chloroethyl)-2,3-dimethylquinoxaline?
The InChIKey is VQHMLWGYXDDTKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2/c1-8-9(2)15-12-7-10(5-6-13)3-4-11(12)14-8/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 6-(2-chloroethyl)-2,3-dimethylquinoxaline?
6-(2-chloroethyl)-2,3-dimethylquinoxaline has a molecular weight of 220.70 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloroethyl)-2,3-dimethylquinoxaline is sourced from PubChem (CID 18436913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).