C11H13N3 — CID 154111208
2,3,7-trimethylquinoxalin-5-amine (PubChem CID 154111208) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2,3,7-trimethylquinoxalin-5-amine.
| Compound Name | 2,3,7-trimethylquinoxalin-5-amine |
|---|---|
| PubChem CID | 154111208 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2,3,7-trimethylquinoxalin-5-amine |
| SMILES | Cc1cc(N)c2nc(C)c(C)nc2c1 |
| InChI | InChI=1S/C11H13N3/c1-6-4-9(12)11-10(5-6)13-7(2)8(3)14-11/h4-5H,12H2,1-3H3 |
| InChIKey | MOOIMECXMZREIL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|