carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine

C11H11N3O2 — CID 123584210

IUPACcarbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine
SMILESCc1cc(N)c2nc(C)ccc2n1.O=C=O
InChIInChI=1S/C10H11N3.CO2/c1-6-3-4-9-10(13-6)8(11)5-7(2)12-9;2-1-3/h3-5H,1-2H3,(H2,11,12);
InChIKeyHHDMHCBXOYZDPW-UHFFFAOYSA-N
MW217.23 g/mol
LogP1.25
Rot. Bonds

About carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine

carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine (PubChem CID 123584210) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine.

Molecular Properties

Compound Namecarbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine
PubChem CID123584210
Molecular FormulaC11H11N3O2
Molecular Weight217.23 g/mol
Exact Mass217.09
IUPAC Namecarbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine
SMILESCc1cc(N)c2nc(C)ccc2n1.O=C=O
InChIInChI=1S/C10H11N3.CO2/c1-6-3-4-9-10(13-6)8(11)5-7(2)12-9;2-1-3/h3-5H,1-2H3,(H2,11,12);
InChIKeyHHDMHCBXOYZDPW-UHFFFAOYSA-N
XLogP1.25
TPSA85.94 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.23
LogP ≤ 51.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine?
The IUPAC name of carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine (CID 123584210) is carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine.
What is the SMILES notation for carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine?
The canonical SMILES for carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine is Cc1cc(N)c2nc(C)ccc2n1.O=C=O.
What is the InChIKey of carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine?
The InChIKey is HHDMHCBXOYZDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3.CO2/c1-6-3-4-9-10(13-6)8(11)5-7(2)12-9;2-1-3/h3-5H,1-2H3,(H2,11,12);.
What are the key properties of carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine?
carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine has a molecular weight of 217.23 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine is sourced from PubChem (CID 123584210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).