C11H11N3O2 — CID 123584210
carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine (PubChem CID 123584210) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine.
| Compound Name | carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 123584210 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | carbon dioxide;2,6-dimethyl-1,5-naphthyridin-4-amine |
| SMILES | Cc1cc(N)c2nc(C)ccc2n1.O=C=O |
| InChI | InChI=1S/C10H11N3.CO2/c1-6-3-4-9-10(13-6)8(11)5-7(2)12-9;2-1-3/h3-5H,1-2H3,(H2,11,12); |
| InChIKey | HHDMHCBXOYZDPW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |