C9H8FN3 — CID 175969109
7-fluoro-2-methyl-1,5-naphthyridin-4-amine (PubChem CID 175969109) has the molecular formula C9H8FN3 and a molecular weight of 177.18 g/mol. Its IUPAC name is 7-fluoro-2-methyl-1,5-naphthyridin-4-amine.
| Compound Name | 7-fluoro-2-methyl-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 175969109 |
| Molecular Formula | C9H8FN3 |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 7-fluoro-2-methyl-1,5-naphthyridin-4-amine |
| SMILES | Cc1cc(N)c2ncc(F)cc2n1 |
| InChI | InChI=1S/C9H8FN3/c1-5-2-7(11)9-8(13-5)3-6(10)4-12-9/h2-4H,1H3,(H2,11,13) |
| InChIKey | NZJSRNDBRJIJCX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |