C7H5BrN2S — CID 153383397
2-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 153383397) has the molecular formula C7H5BrN2S and a molecular weight of 229.10 g/mol. Its IUPAC name is 2-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 2-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 153383397 |
| Molecular Formula | C7H5BrN2S |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | 2-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | Cc1cc2sc(Br)nc2cn1 |
| InChI | InChI=1S/C7H5BrN2S/c1-4-2-6-5(3-9-4)10-7(8)11-6/h2-3H,1H3 |
| InChIKey | GNTLQGRNKCBHOO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |