C9H6BrNOS — CID 11673296
1-(2-bromo-1,3-benzothiazol-6-yl)ethanone (PubChem CID 11673296) has the molecular formula C9H6BrNOS and a molecular weight of 256.12 g/mol. Its IUPAC name is 1-(2-bromo-1,3-benzothiazol-6-yl)ethanone.
| Compound Name | 1-(2-bromo-1,3-benzothiazol-6-yl)ethanone |
|---|---|
| PubChem CID | 11673296 |
| Molecular Formula | C9H6BrNOS |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 254.94 |
| IUPAC Name | 1-(2-bromo-1,3-benzothiazol-6-yl)ethanone |
| SMILES | CC(=O)c1ccc2nc(Br)sc2c1 |
| InChI | InChI=1S/C9H6BrNOS/c1-5(12)6-2-3-7-8(4-6)13-9(10)11-7/h2-4H,1H3 |
| InChIKey | CBHZUGGQNGVHTN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |