C19H14Br2N2OS2 — CID 151446517
2,4-bis(2-bromo-1,3-benzothiazol-6-yl)pentan-3-one (PubChem CID 151446517) has the molecular formula C19H14Br2N2OS2 and a molecular weight of 510.28 g/mol. Its IUPAC name is 2,4-bis(2-bromo-1,3-benzothiazol-6-yl)pentan-3-one.
| Compound Name | 2,4-bis(2-bromo-1,3-benzothiazol-6-yl)pentan-3-one |
|---|---|
| PubChem CID | 151446517 |
| Molecular Formula | C19H14Br2N2OS2 |
| Molecular Weight | 510.28 g/mol |
| Exact Mass | 507.89 |
| IUPAC Name | 2,4-bis(2-bromo-1,3-benzothiazol-6-yl)pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccc2nc(Br)sc2c1)c1ccc2nc(Br)sc2c1 |
| InChI | InChI=1S/C19H14Br2N2OS2/c1-9(11-3-5-13-15(7-11)25-18(20)22-13)17(24)10(2)12-4-6-14-16(8-12)26-19(21)23-14/h3-10H,1-2H3 |
| InChIKey | PFPOVIBSCIEEBM-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.28 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |