C8H6N2O2S — CID 118346731
(6-methyl-[1,3]thiazolo[5,4-c]pyridin-2-yl) formate (PubChem CID 118346731) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is (6-methyl-[1,3]thiazolo[5,4-c]pyridin-2-yl) formate.
| Compound Name | (6-methyl-[1,3]thiazolo[5,4-c]pyridin-2-yl) formate |
|---|---|
| PubChem CID | 118346731 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | (6-methyl-[1,3]thiazolo[5,4-c]pyridin-2-yl) formate |
| SMILES | Cc1cc2nc(OC=O)sc2cn1 |
| InChI | InChI=1S/C8H6N2O2S/c1-5-2-6-7(3-9-5)13-8(10-6)12-4-11/h2-4H,1H3 |
| InChIKey | LKJRRRHYFHXUON-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|