C9H15I5N2S — CID 176683267
ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide (PubChem CID 176683267) has the molecular formula C9H15I5N2S and a molecular weight of 817.82 g/mol. Its IUPAC name is ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide.
| Compound Name | ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide |
|---|---|
| PubChem CID | 176683267 |
| Molecular Formula | C9H15I5N2S |
| Molecular Weight | 817.82 g/mol |
| Exact Mass | 817.62 |
| IUPAC Name | ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide |
| SMILES | CC.Cc1nc2cnc(I)cc2s1.I.I.I.I |
| InChI | InChI=1S/C7H5IN2S.C2H6.4HI/c1-4-10-5-3-9-7(8)2-6(5)11-4;1-2;;;;/h2-3H,1H3;1-2H3;4*1H |
| InChIKey | CPQCWWOIKMQALF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.82 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|