About ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide
ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide (PubChem CID 176683267) has the molecular formula C9H15I5N2S
and a molecular weight of 817.82 g/mol. Its IUPAC name is ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide.
Molecular Properties
| Compound Name | ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide |
| PubChem CID | 176683267 |
| Molecular Formula | C9H15I5N2S |
| Molecular Weight | 817.82 g/mol |
| Exact Mass | 817.62 |
| IUPAC Name | ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide |
| SMILES | CC.Cc1nc2cnc(I)cc2s1.I.I.I.I |
| InChI | InChI=1S/C7H5IN2S.C2H6.4HI/c1-4-10-5-3-9-7(8)2-6(5)11-4;1-2;;;;/h2-3H,1H3;1-2H3;4*1H |
| InChIKey | CPQCWWOIKMQALF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 817.82 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide?
The IUPAC name of ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide (CID 176683267) is ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide.
What is the SMILES notation for ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide?
The canonical SMILES for ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide is CC.Cc1nc2cnc(I)cc2s1.I.I.I.I.
What is the InChIKey of ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide?
The InChIKey is CPQCWWOIKMQALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2S.C2H6.4HI/c1-4-10-5-3-9-7(8)2-6(5)11-4;1-2;;;;/h2-3H,1H3;1-2H3;4*1H.
What are the key properties of ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide?
ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide has a molecular weight of 817.82 g/mol, XLogP of 6.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-iodo-2-methyl-[1,3]thiazolo[4,5-c]pyridine;tetrahydroiodide is sourced from PubChem (CID 176683267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).