C8H8N2S2 — CID 142933865
5-amino-2-methyl-1,3-benzothiazole-6-thiol (PubChem CID 142933865) has the molecular formula C8H8N2S2 and a molecular weight of 196.30 g/mol. Its IUPAC name is 5-amino-2-methyl-1,3-benzothiazole-6-thiol.
| Compound Name | 5-amino-2-methyl-1,3-benzothiazole-6-thiol |
|---|---|
| PubChem CID | 142933865 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 5-amino-2-methyl-1,3-benzothiazole-6-thiol |
| SMILES | Cc1nc2cc(N)c(S)cc2s1 |
| InChI | InChI=1S/C8H8N2S2/c1-4-10-6-2-5(9)7(11)3-8(6)12-4/h2-3,11H,9H2,1H3 |
| InChIKey | DDEMYGYJBIGXJW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|