C16H25N3S — CID 43587843
2-methyl-5-N,5-N-bis(2-methylpropyl)-1,3-benzothiazole-5,6-diamine (PubChem CID 43587843) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-methyl-5-N,5-N-bis(2-methylpropyl)-1,3-benzothiazole-5,6-diamine.
| Compound Name | 2-methyl-5-N,5-N-bis(2-methylpropyl)-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 43587843 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-methyl-5-N,5-N-bis(2-methylpropyl)-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(N(CC(C)C)CC(C)C)c(N)cc2s1 |
| InChI | InChI=1S/C16H25N3S/c1-10(2)8-19(9-11(3)4)15-7-14-16(6-13(15)17)20-12(5)18-14/h6-7,10-11H,8-9,17H2,1-5H3 |
| InChIKey | ITJIOPZXLKWNNK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|