C14H17N5S — CID 61438201
5-N,2-dimethyl-5-N-[(1-methylpyrazol-4-yl)methyl]-1,3-benzothiazole-5,6-diamine (PubChem CID 61438201) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 5-N,2-dimethyl-5-N-[(1-methylpyrazol-4-yl)methyl]-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N,2-dimethyl-5-N-[(1-methylpyrazol-4-yl)methyl]-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 61438201 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-N,2-dimethyl-5-N-[(1-methylpyrazol-4-yl)methyl]-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(N(C)Cc3cnn(C)c3)c(N)cc2s1 |
| InChI | InChI=1S/C14H17N5S/c1-9-17-12-5-13(11(15)4-14(12)20-9)18(2)7-10-6-16-19(3)8-10/h4-6,8H,7,15H2,1-3H3 |
| InChIKey | WONZCFDIQYVKFF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|