C13H19N5O2S — CID 82898113
4-amino-N-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]benzenesulfonamide (PubChem CID 82898113) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 4-amino-N-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]benzenesulfonamide.
| Compound Name | 4-amino-N-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 82898113 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-amino-N-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(N(C)Cc2cnn(C)c2)c1 |
| InChI | InChI=1S/C13H19N5O2S/c1-15-21(19,20)11-4-5-12(14)13(6-11)17(2)8-10-7-16-18(3)9-10/h4-7,9,15H,8,14H2,1-3H3 |
| InChIKey | FKIIIHIFDLRWNF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|