C16H24N6O4S — CID 55370415
N-[2-(dimethylamino)ethyl]-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 55370415) has the molecular formula C16H24N6O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55370415 |
| Molecular Formula | C16H24N6O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(N(C)Cc2cnn(C)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24N6O4S/c1-19(2)8-7-18-27(25,26)14-5-6-15(16(9-14)22(23)24)20(3)11-13-10-17-21(4)12-13/h5-6,9-10,12,18H,7-8,11H2,1-4H3 |
| InChIKey | UKLFJHSCTDISCF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|