C19H26N4O5S — CID 55346987
N-[2-(dimethylamino)ethyl]-4-[(3-methoxyphenyl)methyl-methylamino]-3-nitrobenzenesulfonamide (PubChem CID 55346987) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[(3-methoxyphenyl)methyl-methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[(3-methoxyphenyl)methyl-methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55346987 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[(3-methoxyphenyl)methyl-methylamino]-3-nitrobenzenesulfonamide |
| SMILES | COc1cccc(CN(C)c2ccc(S(=O)(=O)NCCN(C)C)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H26N4O5S/c1-21(2)11-10-20-29(26,27)17-8-9-18(19(13-17)23(24)25)22(3)14-15-6-5-7-16(12-15)28-4/h5-9,12-13,20H,10-11,14H2,1-4H3 |
| InChIKey | BBRDKESFKIECCP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|