C19H24N4O6S — CID 18194942
4-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 18194942) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18194942 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(N(C)Cc2ccc3c(c2)OCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N4O6S/c1-21(2)9-8-20-30(26,27)15-5-6-16(17(11-15)23(24)25)22(3)12-14-4-7-18-19(10-14)29-13-28-18/h4-7,10-11,20H,8-9,12-13H2,1-3H3 |
| InChIKey | NMIDXBSWNFMYIU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|