C15H15Cl2N3O4S — CID 9183682
4-[(3,4-dichlorophenyl)methyl-methylamino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 9183682) has the molecular formula C15H15Cl2N3O4S and a molecular weight of 404.28 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl-methylamino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl-methylamino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9183682 |
| Molecular Formula | C15H15Cl2N3O4S |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl-methylamino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N(C)Cc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15Cl2N3O4S/c1-18-25(23,24)11-4-6-14(15(8-11)20(21)22)19(2)9-10-3-5-12(16)13(17)7-10/h3-8,18H,9H2,1-2H3 |
| InChIKey | XFJGIYVVBAHKCP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|