C15H11F3N2O6S — CID 57404654
N-(1,3-benzodioxol-5-ylmethyl)-3-nitro-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 57404654) has the molecular formula C15H11F3N2O6S and a molecular weight of 404.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-nitro-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-nitro-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57404654 |
| Molecular Formula | C15H11F3N2O6S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-nitro-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCc2ccc3c(c2)OCO3)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H11F3N2O6S/c16-15(17,18)11-3-2-10(6-12(11)20(21)22)27(23,24)19-7-9-1-4-13-14(5-9)26-8-25-13/h1-6,19H,7-8H2 |
| InChIKey | GGWRLJVOAVOSHQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|