C15H13F3N2O4S — CID 67976172
4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 67976172) has the molecular formula C15H13F3N2O4S and a molecular weight of 374.34 g/mol. Its IUPAC name is 4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67976172 |
| Molecular Formula | C15H13F3N2O4S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O4S/c16-15(17,18)11-6-10(2-3-12(11)19)25(21,22)20-7-9-1-4-13-14(5-9)24-8-23-13/h1-6,20H,7-8,19H2 |
| InChIKey | QUBXJFCMWVLHJH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|