C16H16ClN3S — CID 63402580
5-N-[(4-chlorophenyl)methyl]-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine (PubChem CID 63402580) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is 5-N-[(4-chlorophenyl)methyl]-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-[(4-chlorophenyl)methyl]-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 63402580 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-N-[(4-chlorophenyl)methyl]-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(N(C)Cc3ccc(Cl)cc3)c(N)cc2s1 |
| InChI | InChI=1S/C16H16ClN3S/c1-10-19-14-8-15(13(18)7-16(14)21-10)20(2)9-11-3-5-12(17)6-4-11/h3-8H,9,18H2,1-2H3 |
| InChIKey | AXVIMBQSDAYZQX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|