C16H23N3S — CID 63402753
5-N-(cyclohexylmethyl)-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine (PubChem CID 63402753) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 5-N-(cyclohexylmethyl)-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-(cyclohexylmethyl)-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 63402753 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 5-N-(cyclohexylmethyl)-5-N,2-dimethyl-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(N(C)CC3CCCCC3)c(N)cc2s1 |
| InChI | InChI=1S/C16H23N3S/c1-11-18-14-9-15(13(17)8-16(14)20-11)19(2)10-12-6-4-3-5-7-12/h8-9,12H,3-7,10,17H2,1-2H3 |
| InChIKey | DJDSJZIXSHUNQI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|