C14H21IN2 — CID 66063936
1-N-(cyclohexylmethyl)-4-iodo-1-N-methylbenzene-1,2-diamine (PubChem CID 66063936) has the molecular formula C14H21IN2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-N-(cyclohexylmethyl)-4-iodo-1-N-methylbenzene-1,2-diamine.
| Compound Name | 1-N-(cyclohexylmethyl)-4-iodo-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 66063936 |
| Molecular Formula | C14H21IN2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-N-(cyclohexylmethyl)-4-iodo-1-N-methylbenzene-1,2-diamine |
| SMILES | CN(CC1CCCCC1)c1ccc(I)cc1N |
| InChI | InChI=1S/C14H21IN2/c1-17(10-11-5-3-2-4-6-11)14-8-7-12(15)9-13(14)16/h7-9,11H,2-6,10,16H2,1H3 |
| InChIKey | MNCXZHBIDOLMRA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|