C14H20FIN2 — CID 58437592
N-[(4-aminocyclohexyl)methyl]-2-fluoro-4-iodo-N-methylaniline (PubChem CID 58437592) has the molecular formula C14H20FIN2 and a molecular weight of 362.23 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-2-fluoro-4-iodo-N-methylaniline.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-2-fluoro-4-iodo-N-methylaniline |
|---|---|
| PubChem CID | 58437592 |
| Molecular Formula | C14H20FIN2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-2-fluoro-4-iodo-N-methylaniline |
| SMILES | CN(CC1CCC(N)CC1)c1ccc(I)cc1F |
| InChI | InChI=1S/C14H20FIN2/c1-18(9-10-2-5-12(17)6-3-10)14-7-4-11(16)8-13(14)15/h4,7-8,10,12H,2-3,5-6,9,17H2,1H3 |
| InChIKey | ZQNFZALSHZWSEC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|