C16H12ClF3INO — CID 141033295
4-chloro-N-(cyclopropylmethoxy)-2,3-difluoro-N-(2-fluoro-4-iodophenyl)aniline (PubChem CID 141033295) has the molecular formula C16H12ClF3INO and a molecular weight of 453.63 g/mol. Its IUPAC name is 4-chloro-N-(cyclopropylmethoxy)-2,3-difluoro-N-(2-fluoro-4-iodophenyl)aniline.
| Compound Name | 4-chloro-N-(cyclopropylmethoxy)-2,3-difluoro-N-(2-fluoro-4-iodophenyl)aniline |
|---|---|
| PubChem CID | 141033295 |
| Molecular Formula | C16H12ClF3INO |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | 4-chloro-N-(cyclopropylmethoxy)-2,3-difluoro-N-(2-fluoro-4-iodophenyl)aniline |
| SMILES | Fc1cc(I)ccc1N(OCC1CC1)c1ccc(Cl)c(F)c1F |
| InChI | InChI=1S/C16H12ClF3INO/c17-11-4-6-14(16(20)15(11)19)22(23-8-9-1-2-9)13-5-3-10(21)7-12(13)18/h3-7,9H,1-2,8H2 |
| InChIKey | MWWPZTDFINJEDT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|