C17H17ClF2INO3 — CID 141047565
3-(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-2-methoxypropan-1-ol (PubChem CID 141047565) has the molecular formula C17H17ClF2INO3 and a molecular weight of 483.68 g/mol. Its IUPAC name is 3-(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-2-methoxypropan-1-ol.
| Compound Name | 3-(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-2-methoxypropan-1-ol |
|---|---|
| PubChem CID | 141047565 |
| Molecular Formula | C17H17ClF2INO3 |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 3-(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-2-methoxypropan-1-ol |
| SMILES | COC(CO)CON(c1ccc(I)cc1C)c1ccc(Cl)c(F)c1F |
| InChI | InChI=1S/C17H17ClF2INO3/c1-10-7-11(21)3-5-14(10)22(25-9-12(8-23)24-2)15-6-4-13(18)16(19)17(15)20/h3-7,12,23H,8-9H2,1-2H3 |
| InChIKey | ZQKWUFWDNTXMJU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|