C22H19BrF2INO3 — CID 141047583
1-(N-(4-bromo-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-3-phenoxypropan-2-ol (PubChem CID 141047583) has the molecular formula C22H19BrF2INO3 and a molecular weight of 590.20 g/mol. Its IUPAC name is 1-(N-(4-bromo-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-3-phenoxypropan-2-ol.
| Compound Name | 1-(N-(4-bromo-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 141047583 |
| Molecular Formula | C22H19BrF2INO3 |
| Molecular Weight | 590.20 g/mol |
| Exact Mass | 588.96 |
| IUPAC Name | 1-(N-(4-bromo-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxy-3-phenoxypropan-2-ol |
| SMILES | Cc1cc(I)ccc1N(OCC(O)COc1ccccc1)c1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C22H19BrF2INO3/c1-14-11-15(26)7-9-19(14)27(20-10-8-18(23)21(24)22(20)25)30-13-16(28)12-29-17-5-3-2-4-6-17/h2-11,16,28H,12-13H2,1H3 |
| InChIKey | GLZHESIFWGWGFS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.20 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|