C18H17ClF2INO2 — CID 141047589
1-[(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxymethyl]cyclobutan-1-ol (PubChem CID 141047589) has the molecular formula C18H17ClF2INO2 and a molecular weight of 479.69 g/mol. Its IUPAC name is 1-[(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxymethyl]cyclobutan-1-ol.
| Compound Name | 1-[(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxymethyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 141047589 |
| Molecular Formula | C18H17ClF2INO2 |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | 1-[(N-(4-chloro-2,3-difluorophenyl)-4-iodo-2-methylanilino)oxymethyl]cyclobutan-1-ol |
| SMILES | Cc1cc(I)ccc1N(OCC1(O)CCC1)c1ccc(Cl)c(F)c1F |
| InChI | InChI=1S/C18H17ClF2INO2/c1-11-9-12(22)3-5-14(11)23(25-10-18(24)7-2-8-18)15-6-4-13(19)16(20)17(15)21/h3-6,9,24H,2,7-8,10H2,1H3 |
| InChIKey | IHCDXBWLWPUOHG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|