About 2-chloro-N,N-diethyl-4-iodoaniline
2-chloro-N,N-diethyl-4-iodoaniline (PubChem CID 107606923) has the molecular formula C10H13ClIN
and a molecular weight of 309.58 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-iodoaniline.
Molecular Properties
| Compound Name | 2-chloro-N,N-diethyl-4-iodoaniline |
| PubChem CID | 107606923 |
| Molecular Formula | C10H13ClIN |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-iodoaniline |
| SMILES | CCN(CC)c1ccc(I)cc1Cl |
| InChI | InChI=1S/C10H13ClIN/c1-3-13(4-2)10-6-5-8(12)7-9(10)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | VUWFUAMDUUTJEN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-diethyl-4-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-diethyl-4-iodoaniline?
The IUPAC name of 2-chloro-N,N-diethyl-4-iodoaniline (CID 107606923) is 2-chloro-N,N-diethyl-4-iodoaniline.
What is the SMILES notation for 2-chloro-N,N-diethyl-4-iodoaniline?
The canonical SMILES for 2-chloro-N,N-diethyl-4-iodoaniline is CCN(CC)c1ccc(I)cc1Cl.
What is the InChIKey of 2-chloro-N,N-diethyl-4-iodoaniline?
The InChIKey is VUWFUAMDUUTJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClIN/c1-3-13(4-2)10-6-5-8(12)7-9(10)11/h5-7H,3-4H2,1-2H3.
What are the key properties of 2-chloro-N,N-diethyl-4-iodoaniline?
2-chloro-N,N-diethyl-4-iodoaniline has a molecular weight of 309.58 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-diethyl-4-iodoaniline is sourced from PubChem (CID 107606923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).