C13H16ClNO2 — CID 81155438
(E)-3-[3-chloro-4-(diethylamino)phenyl]prop-2-enoic acid (PubChem CID 81155438) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(diethylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-4-(diethylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81155438 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (E)-3-[3-chloro-4-(diethylamino)phenyl]prop-2-enoic acid |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H16ClNO2/c1-3-15(4-2)12-7-5-10(9-11(12)14)6-8-13(16)17/h5-9H,3-4H2,1-2H3,(H,16,17)/b8-6+ |
| InChIKey | JUMFZFZVLMZORK-SOFGYWHQSA-N |
| XLogP | 3.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|